About (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine
(3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine (PubChem CID 104978137) has the molecular formula C6H12F3N3O2S
and a molecular weight of 247.24 g/mol. Its IUPAC name is (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine |
| PubChem CID | 104978137 |
| Molecular Formula | C6H12F3N3O2S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine |
| SMILES | O=S(=O)(NCC(F)(F)F)N[C@H]1CCNC1 |
| InChI | InChI=1S/C6H12F3N3O2S/c7-6(8,9)4-11-15(13,14)12-5-1-2-10-3-5/h5,10-12H,1-4H2/t5-/m0/s1 |
| InChIKey | SGIDADOMBQPGRI-YFKPBYRVSA-N |
| XLogP | -0.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine?
The IUPAC name of (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine (CID 104978137) is (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine.
What is the SMILES notation for (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine?
The canonical SMILES for (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine is O=S(=O)(NCC(F)(F)F)N[C@H]1CCNC1.
What is the InChIKey of (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine?
The InChIKey is SGIDADOMBQPGRI-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H12F3N3O2S/c7-6(8,9)4-11-15(13,14)12-5-1-2-10-3-5/h5,10-12H,1-4H2/t5-/m0/s1.
What are the key properties of (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine?
(3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine has a molecular weight of 247.24 g/mol, XLogP of -0.67, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-(2,2,2-trifluoroethylsulfamoyl)pyrrolidin-3-amine is sourced from PubChem (CID 104978137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).