C8H20N4O3S — CID 104978250
3-[tert-butylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide (PubChem CID 104978250) has the molecular formula C8H20N4O3S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-[tert-butylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[tert-butylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 104978250 |
| Molecular Formula | C8H20N4O3S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-[tert-butylsulfamoyl(methyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CN(CCC(N)=NO)S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C8H20N4O3S/c1-8(2,3)11-16(14,15)12(4)6-5-7(9)10-13/h11,13H,5-6H2,1-4H3,(H2,9,10) |
| InChIKey | QNVMCGJHTQVPNK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|