C10H24N4O3S — CID 104978283
2-(tert-butylsulfamoylamino)-2-ethyl-N'-hydroxybutanimidamide (PubChem CID 104978283) has the molecular formula C10H24N4O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-(tert-butylsulfamoylamino)-2-ethyl-N'-hydroxybutanimidamide.
| Compound Name | 2-(tert-butylsulfamoylamino)-2-ethyl-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 104978283 |
| Molecular Formula | C10H24N4O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(tert-butylsulfamoylamino)-2-ethyl-N'-hydroxybutanimidamide |
| SMILES | CCC(CC)(NS(=O)(=O)NC(C)(C)C)C(N)=NO |
| InChI | InChI=1S/C10H24N4O3S/c1-6-10(7-2,8(11)12-15)14-18(16,17)13-9(3,4)5/h13-15H,6-7H2,1-5H3,(H2,11,12) |
| InChIKey | LQJFPKYJQZZWRY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|