C5H14N4O3S — CID 104978288
N'-hydroxy-2-methyl-2-(methylsulfamoylamino)propanimidamide (PubChem CID 104978288) has the molecular formula C5H14N4O3S and a molecular weight of 210.26 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-2-(methylsulfamoylamino)propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-2-(methylsulfamoylamino)propanimidamide |
|---|---|
| PubChem CID | 104978288 |
| Molecular Formula | C5H14N4O3S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N'-hydroxy-2-methyl-2-(methylsulfamoylamino)propanimidamide |
| SMILES | CNS(=O)(=O)NC(C)(C)C(N)=NO |
| InChI | InChI=1S/C5H14N4O3S/c1-5(2,4(6)8-10)9-13(11,12)7-3/h7,9-10H,1-3H3,(H2,6,8) |
| InChIKey | SZCNGFFXSBYZRZ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|