C13H28N4O3S — CID 104978301
1-(tert-butylsulfamoylamino)-N'-hydroxycyclooctane-1-carboximidamide (PubChem CID 104978301) has the molecular formula C13H28N4O3S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-(tert-butylsulfamoylamino)-N'-hydroxycyclooctane-1-carboximidamide.
| Compound Name | 1-(tert-butylsulfamoylamino)-N'-hydroxycyclooctane-1-carboximidamide |
|---|---|
| PubChem CID | 104978301 |
| Molecular Formula | C13H28N4O3S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-(tert-butylsulfamoylamino)-N'-hydroxycyclooctane-1-carboximidamide |
| SMILES | CC(C)(C)NS(=O)(=O)NC1(C(N)=NO)CCCCCCC1 |
| InChI | InChI=1S/C13H28N4O3S/c1-12(2,3)16-21(19,20)17-13(11(14)15-18)9-7-5-4-6-8-10-13/h16-18H,4-10H2,1-3H3,(H2,14,15) |
| InChIKey | FQFMIUXCOSWZSQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|