C6H16N4O3S — CID 104978307
2-(tert-butylsulfamoylamino)-N'-hydroxyethanimidamide (PubChem CID 104978307) has the molecular formula C6H16N4O3S and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-(tert-butylsulfamoylamino)-N'-hydroxyethanimidamide.
| Compound Name | 2-(tert-butylsulfamoylamino)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 104978307 |
| Molecular Formula | C6H16N4O3S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-(tert-butylsulfamoylamino)-N'-hydroxyethanimidamide |
| SMILES | CC(C)(C)NS(=O)(=O)NCC(N)=NO |
| InChI | InChI=1S/C6H16N4O3S/c1-6(2,3)10-14(12,13)8-4-5(7)9-11/h8,10-11H,4H2,1-3H3,(H2,7,9) |
| InChIKey | LVKSIRYQNDAJHW-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|