C8H17F3N4O3S — CID 104978350
3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 104978350) has the molecular formula C8H17F3N4O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is 3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 104978350 |
| Molecular Formula | C8H17F3N4O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-[ethyl(2,2,2-trifluoroethylsulfamoyl)amino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCN(CC(C)C(N)=NO)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N4O3S/c1-3-15(4-6(2)7(12)14-16)19(17,18)13-5-8(9,10)11/h6,13,16H,3-5H2,1-2H3,(H2,12,14) |
| InChIKey | UHOXLOKPXBYDBX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|