C9H19F3N4O3S — CID 104978380
N'-hydroxy-3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide (PubChem CID 104978380) has the molecular formula C9H19F3N4O3S and a molecular weight of 320.34 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
|---|---|
| PubChem CID | 104978380 |
| Molecular Formula | C9H19F3N4O3S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N'-hydroxy-3-[2-methylpropyl(2,2,2-trifluoroethylsulfamoyl)amino]propanimidamide |
| SMILES | CC(C)CN(CCC(N)=NO)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N4O3S/c1-7(2)5-16(4-3-8(13)15-17)20(18,19)14-6-9(10,11)12/h7,14,17H,3-6H2,1-2H3,(H2,13,15) |
| InChIKey | UPHAASQESWAWGF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|