C9H18F3N5O3S — CID 104978469
N'-hydroxy-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide (PubChem CID 104978469) has the molecular formula C9H18F3N5O3S and a molecular weight of 333.34 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide.
| Compound Name | N'-hydroxy-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 104978469 |
| Molecular Formula | C9H18F3N5O3S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N'-hydroxy-2-[4-(2,2,2-trifluoroethylsulfamoyl)piperazin-1-yl]propanimidamide |
| SMILES | CC(C(N)=NO)N1CCN(S(=O)(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H18F3N5O3S/c1-7(8(13)15-18)16-2-4-17(5-3-16)21(19,20)14-6-9(10,11)12/h7,14,18H,2-6H2,1H3,(H2,13,15) |
| InChIKey | IJWNQWUCTPOFLF-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|