About [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate
[(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate (PubChem CID 10497875) has the molecular formula C20H33NO2Si
and a molecular weight of 347.58 g/mol. Its IUPAC name is [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate |
| PubChem CID | 10497875 |
| Molecular Formula | C20H33NO2Si |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O/C=C/C(c1ccccc1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NO2Si/c1-8-21(9-2)19(22)23-16-15-18(17-13-11-10-12-14-17)24(6,7)20(3,4)5/h10-16,18H,8-9H2,1-7H3/b16-15+ |
| InChIKey | QOFMOEQSTWJRJX-FOCLMDBBSA-N |
| XLogP | 5.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate?
The IUPAC name of [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate (CID 10497875) is [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate.
What is the SMILES notation for [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate?
The canonical SMILES for [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate is CCN(CC)C(=O)O/C=C/C(c1ccccc1)[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate?
The InChIKey is QOFMOEQSTWJRJX-FOCLMDBBSA-N. The full InChI is InChI=1S/C20H33NO2Si/c1-8-21(9-2)19(22)23-16-15-18(17-13-11-10-12-14-17)24(6,7)20(3,4)5/h10-16,18H,8-9H2,1-7H3/b16-15+.
What are the key properties of [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate?
[(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate has a molecular weight of 347.58 g/mol, XLogP of 5.81, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-[tert-butyl(dimethyl)silyl]-3-phenylprop-1-enyl] N,N-diethylcarbamate is sourced from PubChem (CID 10497875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).