About 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile
2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile (PubChem CID 1049791) has the molecular formula C19H18N4OS
and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile |
| PubChem CID | 1049791 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile |
| SMILES | CCc1c(C#N)c(N)nc(SCC(=O)c2ccc(C)cc2C)c1C#N |
| InChI | InChI=1S/C19H18N4OS/c1-4-13-15(8-20)18(22)23-19(16(13)9-21)25-10-17(24)14-6-5-11(2)7-12(14)3/h5-7H,4,10H2,1-3H3,(H2,22,23) |
| InChIKey | WOABMGZAIIESDU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile (CID 1049791) is 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile is CCc1c(C#N)c(N)nc(SCC(=O)c2ccc(C)cc2C)c1C#N.
What is the InChIKey of 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile?
The InChIKey is WOABMGZAIIESDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4OS/c1-4-13-15(8-20)18(22)23-19(16(13)9-21)25-10-17(24)14-6-5-11(2)7-12(14)3/h5-7H,4,10H2,1-3H3,(H2,22,23).
What are the key properties of 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile?
2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile has a molecular weight of 350.45 g/mol, XLogP of 3.56, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[2-(2,4-dimethylphenyl)-2-oxoethyl]sulfanyl-4-ethylpyridine-3,5-dicarbonitrile is sourced from PubChem (CID 1049791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).