C15H27N3O — CID 104979519
2-[azepan-4-yl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 104979519) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[azepan-4-yl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[azepan-4-yl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 104979519 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2-[azepan-4-yl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN(C)C1CCCNCC1 |
| InChI | InChI=1S/C15H27N3O/c1-4-11-18(12-5-2)15(19)13-17(3)14-7-6-9-16-10-8-14/h4-5,14,16H,1-2,6-13H2,3H3 |
| InChIKey | QBWJLHMIXDTCSZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|