About (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine
(NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine (PubChem CID 10498019) has the molecular formula C16H16BrNOS
and a molecular weight of 350.28 g/mol. Its IUPAC name is (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine |
| PubChem CID | 10498019 |
| Molecular Formula | C16H16BrNOS |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine |
| SMILES | CC1(C)C/C(=N\O)c2cc(-c3ccc(Br)cc3)sc2C1 |
| InChI | InChI=1S/C16H16BrNOS/c1-16(2)8-13(18-19)12-7-14(20-15(12)9-16)10-3-5-11(17)6-4-10/h3-7,19H,8-9H2,1-2H3/b18-13+ |
| InChIKey | IBKJZCXCWGSJTA-QGOAFFKASA-N |
| XLogP | 5.33 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine?
The IUPAC name of (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine (CID 10498019) is (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine is CC1(C)C/C(=N\O)c2cc(-c3ccc(Br)cc3)sc2C1.
What is the InChIKey of (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine?
The InChIKey is IBKJZCXCWGSJTA-QGOAFFKASA-N. The full InChI is InChI=1S/C16H16BrNOS/c1-16(2)8-13(18-19)12-7-14(20-15(12)9-16)10-3-5-11(17)6-4-10/h3-7,19H,8-9H2,1-2H3/b18-13+.
What are the key properties of (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine?
(NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine has a molecular weight of 350.28 g/mol, XLogP of 5.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[2-(4-bromophenyl)-6,6-dimethyl-5,7-dihydro-1-benzothiophen-4-ylidene]hydroxylamine is sourced from PubChem (CID 10498019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).