C14H21ClN2O — CID 104980221
2-[5-chloro-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanamine (PubChem CID 104980221) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-[5-chloro-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanamine.
| Compound Name | 2-[5-chloro-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 104980221 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-[5-chloro-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanamine |
| SMILES | C[C@@H]1CN(c2ccc(Cl)cc2CCN)C[C@H](C)O1 |
| InChI | InChI=1S/C14H21ClN2O/c1-10-8-17(9-11(2)18-10)14-4-3-13(15)7-12(14)5-6-16/h3-4,7,10-11H,5-6,8-9,16H2,1-2H3/t10-,11+ |
| InChIKey | ONDTVFMONOFWGX-PHIMTYICSA-N |
| XLogP | 2.45 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |