C10H14N2O4 — CID 104981474
2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 104981474) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | 2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104981474 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-hydroxy-N-[(2S)-1-hydroxybutan-2-yl]-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | CC[C@@H](CO)NC(=O)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C10H14N2O4/c1-2-7(5-13)11-10(16)6-3-8(14)12-9(15)4-6/h3-4,7,13H,2,5H2,1H3,(H,11,16)(H2,12,14,15)/t7-/m0/s1 |
| InChIKey | OJUSYEDJOLMLSE-ZETCQYMHSA-N |
| XLogP | -0.42 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |