About [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate
[2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 10498210) has the molecular formula C19H28O4S
and a molecular weight of 352.50 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate |
| PubChem CID | 10498210 |
| Molecular Formula | C19H28O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CCC/C=C/SC)cc(OC)c1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H28O4S/c1-19(2,3)18(20)23-17-15(21-4)12-14(13-16(17)22-5)10-8-7-9-11-24-6/h9,11-13H,7-8,10H2,1-6H3/b11-9+ |
| InChIKey | YSQTVFKGHITUJE-PKNBQFBNSA-N |
| XLogP | 4.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate?
The IUPAC name of [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate (CID 10498210) is [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate?
The canonical SMILES for [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate is COc1cc(CCC/C=C/SC)cc(OC)c1OC(=O)C(C)(C)C.
What is the InChIKey of [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate?
The InChIKey is YSQTVFKGHITUJE-PKNBQFBNSA-N. The full InChI is InChI=1S/C19H28O4S/c1-19(2,3)18(20)23-17-15(21-4)12-14(13-16(17)22-5)10-8-7-9-11-24-6/h9,11-13H,7-8,10H2,1-6H3/b11-9+.
What are the key properties of [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate?
[2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate has a molecular weight of 352.50 g/mol, XLogP of 4.85, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethoxy-4-[(E)-5-methylsulfanylpent-4-enyl]phenyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 10498210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).