C16H13NO4 — CID 104982102
5-[(3-nitrophenyl)methoxy]-2,3-dihydroinden-1-one (PubChem CID 104982102) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 5-[(3-nitrophenyl)methoxy]-2,3-dihydroinden-1-one.
| Compound Name | 5-[(3-nitrophenyl)methoxy]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 104982102 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-[(3-nitrophenyl)methoxy]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OCc3cccc([N+](=O)[O-])c3)ccc21 |
| InChI | InChI=1S/C16H13NO4/c18-16-7-4-12-9-14(5-6-15(12)16)21-10-11-2-1-3-13(8-11)17(19)20/h1-3,5-6,8-9H,4,7,10H2 |
| InChIKey | SUXZYNDJIYSSRD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|