C10H17N5O — CID 104982379
5-ethyl-N-[(3S)-piperidin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 104982379) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-ethyl-N-[(3S)-piperidin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-ethyl-N-[(3S)-piperidin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 104982379 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 5-ethyl-N-[(3S)-piperidin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCc1nc(C(=O)N[C@H]2CCCNC2)n[nH]1 |
| InChI | InChI=1S/C10H17N5O/c1-2-8-13-9(15-14-8)10(16)12-7-4-3-5-11-6-7/h7,11H,2-6H2,1H3,(H,12,16)(H,13,14,15)/t7-/m0/s1 |
| InChIKey | FEXQESLNNHLHJW-ZETCQYMHSA-N |
| XLogP | -0.15 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |