C17H22O8 — CID 10498309
diethyl (1R,2R,3S,4R,8R)-8-formyl-1,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 10498309) has the molecular formula C17H22O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is diethyl (1R,2R,3S,4R,8R)-8-formyl-1,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | diethyl (1R,2R,3S,4R,8R)-8-formyl-1,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10498309 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | diethyl (1R,2R,3S,4R,8R)-8-formyl-1,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OCC)[C@]2(OC)C=C[C@H]1[C@](C=O)(OC)C2=O |
| InChI | InChI=1S/C17H22O8/c1-5-24-13(19)11-10-7-8-16(22-3,12(11)14(20)25-6-2)15(21)17(10,9-18)23-4/h7-12H,5-6H2,1-4H3/t10-,11+,12+,16-,17+/m1/s1 |
| InChIKey | ZDIUBORGFARUBJ-XJSUSFSXSA-N |
| XLogP | 0.08 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|