C15H21N3O — CID 104983451
(1S)-1-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-3-phenylpropan-1-amine (PubChem CID 104983451) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is (1S)-1-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-3-phenylpropan-1-amine.
| Compound Name | (1S)-1-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 104983451 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (1S)-1-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-3-phenylpropan-1-amine |
| SMILES | CCC(C)c1noc([C@@H](N)CCc2ccccc2)n1 |
| InChI | InChI=1S/C15H21N3O/c1-3-11(2)14-17-15(19-18-14)13(16)10-9-12-7-5-4-6-8-12/h4-8,11,13H,3,9-10,16H2,1-2H3/t11?,13-/m0/s1 |
| InChIKey | QCEVREYRDSAROQ-YUZLPWPTSA-N |
| XLogP | 3.22 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |