About N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide
N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide (PubChem CID 1049842) has the molecular formula C19H17NO4S
and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide |
| PubChem CID | 1049842 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide |
| SMILES | COc1ccc(CN(C=O)/C=C2\Sc3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C19H17NO4S/c1-23-15-8-7-13(9-16(15)24-2)10-20(12-21)11-18-19(22)14-5-3-4-6-17(14)25-18/h3-9,11-12H,10H2,1-2H3/b18-11- |
| InChIKey | BZCKMEVDISHKAU-WQRHYEAKSA-N |
| XLogP | 3.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_E(44)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide (CID 1049842) is N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide is COc1ccc(CN(C=O)/C=C2\Sc3ccccc3C2=O)cc1OC.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide?
The InChIKey is BZCKMEVDISHKAU-WQRHYEAKSA-N. The full InChI is InChI=1S/C19H17NO4S/c1-23-15-8-7-13(9-16(15)24-2)10-20(12-21)11-18-19(22)14-5-3-4-6-17(14)25-18/h3-9,11-12H,10H2,1-2H3/b18-11-.
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide?
N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide has a molecular weight of 355.42 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]formamide is sourced from PubChem (CID 1049842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).