C16H24N2OS — CID 104984443
(2S)-2-amino-1-(2,6-dimethylthiomorpholin-4-yl)-4-phenylbutan-1-one (PubChem CID 104984443) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is (2S)-2-amino-1-(2,6-dimethylthiomorpholin-4-yl)-4-phenylbutan-1-one.
| Compound Name | (2S)-2-amino-1-(2,6-dimethylthiomorpholin-4-yl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 104984443 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2S)-2-amino-1-(2,6-dimethylthiomorpholin-4-yl)-4-phenylbutan-1-one |
| SMILES | CC1CN(C(=O)[C@@H](N)CCc2ccccc2)CC(C)S1 |
| InChI | InChI=1S/C16H24N2OS/c1-12-10-18(11-13(2)20-12)16(19)15(17)9-8-14-6-4-3-5-7-14/h3-7,12-13,15H,8-11,17H2,1-2H3/t12?,13?,15-/m0/s1 |
| InChIKey | GIEIVMMHHRWLIB-PIMMBPRGSA-N |
| XLogP | 2.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |