C15H19N3O2 — CID 104984517
(2S)-2-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-phenylbutanamide (PubChem CID 104984517) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-phenylbutanamide.
| Compound Name | (2S)-2-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 104984517 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2S)-2-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-phenylbutanamide |
| SMILES | Cc1noc(NC(=O)[C@@H](N)CCc2ccccc2)c1C |
| InChI | InChI=1S/C15H19N3O2/c1-10-11(2)18-20-15(10)17-14(19)13(16)9-8-12-6-4-3-5-7-12/h3-7,13H,8-9,16H2,1-2H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | AUHCZIGQDSVBOU-ZDUSSCGKSA-N |
| XLogP | 2.19 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |