C22H28O4 — CID 10498480
5-benzyl-5-[(E)-3-cyclohexylprop-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 10498480) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 5-benzyl-5-[(E)-3-cyclohexylprop-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-benzyl-5-[(E)-3-cyclohexylprop-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10498480 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 5-benzyl-5-[(E)-3-cyclohexylprop-2-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C/C=C/C2CCCCC2)(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C22H28O4/c1-21(2)25-19(23)22(20(24)26-21,16-18-12-7-4-8-13-18)15-9-14-17-10-5-3-6-11-17/h4,7-9,12-14,17H,3,5-6,10-11,15-16H2,1-2H3/b14-9+ |
| InChIKey | QKNLQECOGAPALQ-NTEUORMPSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|