C15H22ClNO3 — CID 104985516
4-[[2-chloro-4-[(1S)-1-hydroxyethyl]-N-methylanilino]methyl]oxan-4-ol (PubChem CID 104985516) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(1S)-1-hydroxyethyl]-N-methylanilino]methyl]oxan-4-ol.
| Compound Name | 4-[[2-chloro-4-[(1S)-1-hydroxyethyl]-N-methylanilino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 104985516 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[[2-chloro-4-[(1S)-1-hydroxyethyl]-N-methylanilino]methyl]oxan-4-ol |
| SMILES | C[C@H](O)c1ccc(N(C)CC2(O)CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO3/c1-11(18)12-3-4-14(13(16)9-12)17(2)10-15(19)5-7-20-8-6-15/h3-4,9,11,18-19H,5-8,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | FVNSUOFBWCZJEH-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|