About CID 10498610
CID 10498610 (PubChem CID 10498610) has the molecular formula C26H32
and a molecular weight of 344.54 g/mol.
Molecular Properties
| Compound Name | CID 10498610 |
| PubChem CID | 10498610 |
| Molecular Formula | C26H32 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@H]2C[C]3[CH][CH][C](CC[C]4[CH][CH][C]5C[C@H]6C[C@@H]([C]45)C6(C)C)[C]3[C@@H]1C2 |
| InChI | InChI=1S/C26H32/c1-25(2)19-11-17-9-7-15(23(17)21(25)13-19)5-6-16-8-10-18-12-20-14-22(24(16)18)26(20,3)4/h7-10,19-22H,5-6,11-14H2,1-4H3/t19-,20-,21-,22-/m0/s1 |
| InChIKey | XGDYCHYATLZZQZ-CMOCDZPBSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 10498610 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10498610?
The IUPAC name of CID 10498610 (CID 10498610) is not available.
What is the SMILES notation for CID 10498610?
The canonical SMILES for CID 10498610 is CC1(C)[C@H]2C[C]3[CH][CH][C](CC[C]4[CH][CH][C]5C[C@H]6C[C@@H]([C]45)C6(C)C)[C]3[C@@H]1C2.
What is the InChIKey of CID 10498610?
The InChIKey is XGDYCHYATLZZQZ-CMOCDZPBSA-N. The full InChI is InChI=1S/C26H32/c1-25(2)19-11-17-9-7-15(23(17)21(25)13-19)5-6-16-8-10-18-12-20-14-22(24(16)18)26(20,3)4/h7-10,19-22H,5-6,11-14H2,1-4H3/t19-,20-,21-,22-/m0/s1.
What are the key properties of CID 10498610?
CID 10498610 has a molecular weight of 344.54 g/mol, XLogP of 6.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10498610 is sourced from PubChem (CID 10498610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).