About 1-ethylsulfonyl-5,6-dimethylheptan-4-amine
1-ethylsulfonyl-5,6-dimethylheptan-4-amine (PubChem CID 104986203) has the molecular formula C11H25NO2S
and a molecular weight of 235.39 g/mol. Its IUPAC name is 1-ethylsulfonyl-5,6-dimethylheptan-4-amine.
Molecular Properties
| Compound Name | 1-ethylsulfonyl-5,6-dimethylheptan-4-amine |
| PubChem CID | 104986203 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-ethylsulfonyl-5,6-dimethylheptan-4-amine |
| SMILES | CCS(=O)(=O)CCCC(N)C(C)C(C)C |
| InChI | InChI=1S/C11H25NO2S/c1-5-15(13,14)8-6-7-11(12)10(4)9(2)3/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | YFZZQPFYIDMLIC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylsulfonyl-5,6-dimethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonyl-5,6-dimethylheptan-4-amine?
The IUPAC name of 1-ethylsulfonyl-5,6-dimethylheptan-4-amine (CID 104986203) is 1-ethylsulfonyl-5,6-dimethylheptan-4-amine.
What is the SMILES notation for 1-ethylsulfonyl-5,6-dimethylheptan-4-amine?
The canonical SMILES for 1-ethylsulfonyl-5,6-dimethylheptan-4-amine is CCS(=O)(=O)CCCC(N)C(C)C(C)C.
What is the InChIKey of 1-ethylsulfonyl-5,6-dimethylheptan-4-amine?
The InChIKey is YFZZQPFYIDMLIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2S/c1-5-15(13,14)8-6-7-11(12)10(4)9(2)3/h9-11H,5-8,12H2,1-4H3.
What are the key properties of 1-ethylsulfonyl-5,6-dimethylheptan-4-amine?
1-ethylsulfonyl-5,6-dimethylheptan-4-amine has a molecular weight of 235.39 g/mol, XLogP of 1.82, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonyl-5,6-dimethylheptan-4-amine is sourced from PubChem (CID 104986203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).