C22H21N3O2 — CID 10498676
(1R,4S)-2-benzyl-4-methyl-1-prop-2-enyl-1,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione (PubChem CID 10498676) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (1R,4S)-2-benzyl-4-methyl-1-prop-2-enyl-1,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione.
| Compound Name | (1R,4S)-2-benzyl-4-methyl-1-prop-2-enyl-1,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 10498676 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (1R,4S)-2-benzyl-4-methyl-1-prop-2-enyl-1,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione |
| SMILES | C=CC[C@@H]1c2nc3ccccc3c(=O)n2[C@@H](C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H21N3O2/c1-3-9-19-20-23-18-13-8-7-12-17(18)22(27)25(20)15(2)21(26)24(19)14-16-10-5-4-6-11-16/h3-8,10-13,15,19H,1,9,14H2,2H3/t15-,19+/m0/s1 |
| InChIKey | MKCBQGPQYMFSFK-HNAYVOBHSA-N |
| XLogP | 3.62 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|