About (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine
(2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine (PubChem CID 10498740) has the molecular formula C21H26F2N2O
and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine.
Molecular Properties
| Compound Name | (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine |
| PubChem CID | 10498740 |
| Molecular Formula | C21H26F2N2O |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)[C@@H](C)CN1 |
| InChI | InChI=1S/C21H26F2N2O/c1-15-14-25(16(2)13-24-15)11-12-26-21(17-3-7-19(22)8-4-17)18-5-9-20(23)10-6-18/h3-10,15-16,21,24H,11-14H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | ANYGZQHMXQTJQV-CVEARBPZSA-N |
| XLogP | 3.75 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine?
The IUPAC name of (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine (CID 10498740) is (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine.
What is the SMILES notation for (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine?
The canonical SMILES for (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine is C[C@@H]1CN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)[C@@H](C)CN1.
What is the InChIKey of (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine?
The InChIKey is ANYGZQHMXQTJQV-CVEARBPZSA-N. The full InChI is InChI=1S/C21H26F2N2O/c1-15-14-25(16(2)13-24-15)11-12-26-21(17-3-7-19(22)8-4-17)18-5-9-20(23)10-6-18/h3-10,15-16,21,24H,11-14H2,1-2H3/t15-,16+/m1/s1.
What are the key properties of (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine?
(2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine has a molecular weight of 360.45 g/mol, XLogP of 3.75, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,5-dimethylpiperazine is sourced from PubChem (CID 10498740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).