C12H15BrClN — CID 104987729
1-(4-bromo-3-chlorophenyl)-N-methylpent-4-en-1-amine (PubChem CID 104987729) has the molecular formula C12H15BrClN and a molecular weight of 288.62 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-N-methylpent-4-en-1-amine.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-N-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 104987729 |
| Molecular Formula | C12H15BrClN |
| Molecular Weight | 288.62 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-N-methylpent-4-en-1-amine |
| SMILES | C=CCCC(NC)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C12H15BrClN/c1-3-4-5-12(15-2)9-6-7-10(13)11(14)8-9/h3,6-8,12,15H,1,4-5H2,2H3 |
| InChIKey | DJEPORKESIOUHE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|