C19H23NO4S — CID 10498811
N-[4-(2-hydroxy-3-phenoxypropoxy)phenyl]-3-methylsulfanylpropanamide (PubChem CID 10498811) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is N-[4-(2-hydroxy-3-phenoxypropoxy)phenyl]-3-methylsulfanylpropanamide.
| Compound Name | N-[4-(2-hydroxy-3-phenoxypropoxy)phenyl]-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 10498811 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[4-(2-hydroxy-3-phenoxypropoxy)phenyl]-3-methylsulfanylpropanamide |
| SMILES | CSCCC(=O)Nc1ccc(OCC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-25-12-11-19(22)20-15-7-9-18(10-8-15)24-14-16(21)13-23-17-5-3-2-4-6-17/h2-10,16,21H,11-14H2,1H3,(H,20,22) |
| InChIKey | VWWQDWBOGARJCJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |