C16H21BrF3N — CID 104988173
1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methyl-1-(4-methylcyclohexyl)methanamine (PubChem CID 104988173) has the molecular formula C16H21BrF3N and a molecular weight of 364.25 g/mol. Its IUPAC name is 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methyl-1-(4-methylcyclohexyl)methanamine.
| Compound Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methyl-1-(4-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 104988173 |
| Molecular Formula | C16H21BrF3N |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-N-methyl-1-(4-methylcyclohexyl)methanamine |
| SMILES | CNC(c1ccc(Br)c(C(F)(F)F)c1)C1CCC(C)CC1 |
| InChI | InChI=1S/C16H21BrF3N/c1-10-3-5-11(6-4-10)15(21-2)12-7-8-14(17)13(9-12)16(18,19)20/h7-11,15,21H,3-6H2,1-2H3 |
| InChIKey | KQMBFELNCMYPAG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |