C23H27N2O2+ — CID 10498880
(E)-2-[(1S,2R,3S)-2-benzyl-3-(4-methoxyphenyl)-1-methylcyclohexyl]-2-hydroxyethenediazonium (PubChem CID 10498880) has the molecular formula C23H27N2O2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is (E)-2-[(1S,2R,3S)-2-benzyl-3-(4-methoxyphenyl)-1-methylcyclohexyl]-2-hydroxyethenediazonium.
| Compound Name | (E)-2-[(1S,2R,3S)-2-benzyl-3-(4-methoxyphenyl)-1-methylcyclohexyl]-2-hydroxyethenediazonium |
|---|---|
| PubChem CID | 10498880 |
| Molecular Formula | C23H27N2O2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | (E)-2-[(1S,2R,3S)-2-benzyl-3-(4-methoxyphenyl)-1-methylcyclohexyl]-2-hydroxyethenediazonium |
| SMILES | COc1ccc([C@H]2CCC[C@](C)(/C(O)=C\[N+]#N)[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-23(22(26)16-25-24)14-6-9-20(18-10-12-19(27-2)13-11-18)21(23)15-17-7-4-3-5-8-17/h3-5,7-8,10-13,16,20-21H,6,9,14-15H2,1-2H3/p+1/b22-16+/t20-,21-,23+/m1/s1 |
| InChIKey | NKMUYCICAMQYNG-BCYPDYFFSA-O |
| XLogP | 6.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|