C22H23NO2S — CID 10499089
(1R,2R,3R,4S)-2-benzyl-3-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 10499089) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is (1R,2R,3R,4S)-2-benzyl-3-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,3R,4S)-2-benzyl-3-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 10499089 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (1R,2R,3R,4S)-2-benzyl-3-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1ccc([S@](=O)[C@@H]2[C@@H]3C=C[C@@H](C3)[C@]2(Cc2ccccc2)C(N)=O)cc1 |
| InChI | InChI=1S/C22H23NO2S/c1-15-7-11-19(12-8-15)26(25)20-17-9-10-18(13-17)22(20,21(23)24)14-16-5-3-2-4-6-16/h2-12,17-18,20H,13-14H2,1H3,(H2,23,24)/t17-,18+,20-,22+,26+/m1/s1 |
| InChIKey | IQQGWORISSQTCY-XVTZQTEKSA-N |
| XLogP | 3.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|