C18H30N4S2 — CID 10499165
4,6,6-trimethyl-3-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)butyl]-1H-pyrimidine-2-thione (PubChem CID 10499165) has the molecular formula C18H30N4S2 and a molecular weight of 366.60 g/mol. Its IUPAC name is 4,6,6-trimethyl-3-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)butyl]-1H-pyrimidine-2-thione.
| Compound Name | 4,6,6-trimethyl-3-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)butyl]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 10499165 |
| Molecular Formula | C18H30N4S2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4,6,6-trimethyl-3-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)butyl]-1H-pyrimidine-2-thione |
| SMILES | CC1=CC(C)(C)NC(=S)N1CCCCN1C(=S)NC(C)(C)C=C1C |
| InChI | InChI=1S/C18H30N4S2/c1-13-11-17(3,4)19-15(23)21(13)9-7-8-10-22-14(2)12-18(5,6)20-16(22)24/h11-12H,7-10H2,1-6H3,(H,19,23)(H,20,24) |
| InChIKey | NAFWOXSHLOOTSH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|