C22H46Si2 — CID 10499172
trimethyl-(1,2,3,4-tetratert-butyl-2H-silet-1-yl)silane (PubChem CID 10499172) has the molecular formula C22H46Si2 and a molecular weight of 366.78 g/mol. Its IUPAC name is trimethyl-(1,2,3,4-tetratert-butyl-2H-silet-1-yl)silane.
| Compound Name | trimethyl-(1,2,3,4-tetratert-butyl-2H-silet-1-yl)silane |
|---|---|
| PubChem CID | 10499172 |
| Molecular Formula | C22H46Si2 |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | trimethyl-(1,2,3,4-tetratert-butyl-2H-silet-1-yl)silane |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)[Si](C(C)(C)C)([Si](C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C22H46Si2/c1-19(2,3)16-17(20(4,5)6)24(22(10,11)12,23(13,14)15)18(16)21(7,8)9/h17H,1-15H3 |
| InChIKey | KFSJVBZWDFDGML-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|