C22H17N5O — CID 10499201
4-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (PubChem CID 10499201) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
| Compound Name | 4-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
|---|---|
| PubChem CID | 10499201 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-(benzylamino)-2-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| SMILES | O=c1n(-c2ccccc2)nc2c(NCc3ccccc3)nc3ccccc3n12 |
| InChI | InChI=1S/C22H17N5O/c28-22-26-19-14-8-7-13-18(19)24-20(23-15-16-9-3-1-4-10-16)21(26)25-27(22)17-11-5-2-6-12-17/h1-14H,15H2,(H,23,24) |
| InChIKey | ZUEKHVLHKBLSKT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |