C26H25NO — CID 10499217
5-benzyl-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 10499217) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is 5-benzyl-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 5-benzyl-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 10499217 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 5-benzyl-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)C(Cc1ccccc1)Oc1ccccc1-3 |
| InChI | InChI=1S/C26H25NO/c1-17-16-26(2,3)27-21-14-13-20-19-11-7-8-12-22(19)28-23(25(20)24(17)21)15-18-9-5-4-6-10-18/h4-14,16,23,27H,15H2,1-3H3 |
| InChIKey | DVHGADYDUXNLKV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |