C9H18F3NO2S — CID 104992780
6,6,6-trifluoro-N,2-dimethyl-2-methylsulfonylhexan-3-amine (PubChem CID 104992780) has the molecular formula C9H18F3NO2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 6,6,6-trifluoro-N,2-dimethyl-2-methylsulfonylhexan-3-amine.
| Compound Name | 6,6,6-trifluoro-N,2-dimethyl-2-methylsulfonylhexan-3-amine |
|---|---|
| PubChem CID | 104992780 |
| Molecular Formula | C9H18F3NO2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6,6,6-trifluoro-N,2-dimethyl-2-methylsulfonylhexan-3-amine |
| SMILES | CNC(CCC(F)(F)F)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H18F3NO2S/c1-8(2,16(4,14)15)7(13-3)5-6-9(10,11)12/h7,13H,5-6H2,1-4H3 |
| InChIKey | DVOMVOBZZUQICG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |