About 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine
1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine (PubChem CID 104992893) has the molecular formula C15H24F3N
and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine |
| PubChem CID | 104992893 |
| Molecular Formula | C15H24F3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine |
| SMILES | NC(CCC(F)(F)F)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24F3N/c16-15(17,18)2-1-13(19)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-13H,1-9,19H2 |
| InChIKey | UTYIVWQZCTUDGZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine?
The IUPAC name of 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine (CID 104992893) is 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine.
What is the SMILES notation for 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine?
The canonical SMILES for 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine is NC(CCC(F)(F)F)CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine?
The InChIKey is UTYIVWQZCTUDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F3N/c16-15(17,18)2-1-13(19)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-13H,1-9,19H2.
What are the key properties of 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine?
1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine has a molecular weight of 275.36 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine is sourced from PubChem (CID 104992893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).