C15H24F3N — CID 104992893
1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine (PubChem CID 104992893) has the molecular formula C15H24F3N and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine.
| Compound Name | 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine |
|---|---|
| PubChem CID | 104992893 |
| Molecular Formula | C15H24F3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-(1-adamantyl)-5,5,5-trifluoropentan-2-amine |
| SMILES | NC(CCC(F)(F)F)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24F3N/c16-15(17,18)2-1-13(19)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-13H,1-9,19H2 |
| InChIKey | UTYIVWQZCTUDGZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |