C14H29NO — CID 104993166
N,5,6-trimethyl-1-(oxolan-2-yl)heptan-4-amine (PubChem CID 104993166) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is N,5,6-trimethyl-1-(oxolan-2-yl)heptan-4-amine.
| Compound Name | N,5,6-trimethyl-1-(oxolan-2-yl)heptan-4-amine |
|---|---|
| PubChem CID | 104993166 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N,5,6-trimethyl-1-(oxolan-2-yl)heptan-4-amine |
| SMILES | CNC(CCCC1CCCO1)C(C)C(C)C |
| InChI | InChI=1S/C14H29NO/c1-11(2)12(3)14(15-4)9-5-7-13-8-6-10-16-13/h11-15H,5-10H2,1-4H3 |
| InChIKey | WCLLPCFDTJGJJL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |