C16H23Br2NO — CID 104993304
1-(2,5-dibromophenyl)-N-ethyl-4-(oxolan-2-yl)butan-1-amine (PubChem CID 104993304) has the molecular formula C16H23Br2NO and a molecular weight of 405.17 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-N-ethyl-4-(oxolan-2-yl)butan-1-amine.
| Compound Name | 1-(2,5-dibromophenyl)-N-ethyl-4-(oxolan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 104993304 |
| Molecular Formula | C16H23Br2NO |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 1-(2,5-dibromophenyl)-N-ethyl-4-(oxolan-2-yl)butan-1-amine |
| SMILES | CCNC(CCCC1CCCO1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H23Br2NO/c1-2-19-16(7-3-5-13-6-4-10-20-13)14-11-12(17)8-9-15(14)18/h8-9,11,13,16,19H,2-7,10H2,1H3 |
| InChIKey | XYXPHCDKCUJIQS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |