C17H25Cl2NO — CID 104993435
1-(2,5-dichlorophenyl)-4-(oxolan-2-yl)-N-propylbutan-1-amine (PubChem CID 104993435) has the molecular formula C17H25Cl2NO and a molecular weight of 330.30 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-4-(oxolan-2-yl)-N-propylbutan-1-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-4-(oxolan-2-yl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 104993435 |
| Molecular Formula | C17H25Cl2NO |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-4-(oxolan-2-yl)-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCC1CCCO1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H25Cl2NO/c1-2-10-20-17(7-3-5-14-6-4-11-21-14)15-12-13(18)8-9-16(15)19/h8-9,12,14,17,20H,2-7,10-11H2,1H3 |
| InChIKey | JWFCYZKGPOYNAO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |