C13H25NO2 — CID 104993652
1,5-bis(oxolan-2-yl)pentan-3-amine (PubChem CID 104993652) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 1,5-bis(oxolan-2-yl)pentan-3-amine.
| Compound Name | 1,5-bis(oxolan-2-yl)pentan-3-amine |
|---|---|
| PubChem CID | 104993652 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 1,5-bis(oxolan-2-yl)pentan-3-amine |
| SMILES | NC(CCC1CCCO1)CCC1CCCO1 |
| InChI | InChI=1S/C13H25NO2/c14-11(5-7-12-3-1-9-15-12)6-8-13-4-2-10-16-13/h11-13H,1-10,14H2 |
| InChIKey | SQZJEAMEAYZLSG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |