C22H26O5 — CID 10499397
(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 10499397) has the molecular formula C22H26O5 and a molecular weight of 370.44 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 10499397 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C22H26O5/c1-22(2)26-20-19(24-14-17-11-7-4-8-12-17)18(25-21(20)27-22)15-23-13-16-9-5-3-6-10-16/h3-12,18-21H,13-15H2,1-2H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | GBXGYTMNXJKHRO-PLACYPQZSA-N |
| XLogP | 3.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |