About N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide
N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide (PubChem CID 10499401) has the molecular formula C24H22N2O2
and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide |
| PubChem CID | 10499401 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(C(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H22N2O2/c27-23(17-18-7-2-1-3-8-18)25-21-14-12-20(13-15-21)24(28)26-16-6-10-19-9-4-5-11-22(19)26/h1-5,7-9,11-15H,6,10,16-17H2,(H,25,27) |
| InChIKey | MCUDYWOOVOYIFL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide?
The IUPAC name of N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide (CID 10499401) is N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide.
What is the SMILES notation for N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide?
The canonical SMILES for N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide is O=C(Cc1ccccc1)Nc1ccc(C(=O)N2CCCc3ccccc32)cc1.
What is the InChIKey of N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide?
The InChIKey is MCUDYWOOVOYIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O2/c27-23(17-18-7-2-1-3-8-18)25-21-14-12-20(13-15-21)24(28)26-16-6-10-19-9-4-5-11-22(19)26/h1-5,7-9,11-15H,6,10,16-17H2,(H,25,27).
What are the key properties of N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide?
N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide has a molecular weight of 370.45 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2-phenylacetamide is sourced from PubChem (CID 10499401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).