C18H30O6Si — CID 10499411
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxane-3,5-diol (PubChem CID 10499411) has the molecular formula C18H30O6Si and a molecular weight of 370.52 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxane-3,5-diol |
|---|---|
| PubChem CID | 10499411 |
| Molecular Formula | C18H30O6Si |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-4-phenylmethoxy-6-(2-trimethylsilylethoxy)oxane-3,5-diol |
| SMILES | C[Si](C)(C)CCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C18H30O6Si/c1-25(2,3)10-9-22-18-16(21)17(15(20)14(11-19)24-18)23-12-13-7-5-4-6-8-13/h4-8,14-21H,9-12H2,1-3H3/t14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | YDOBGYPRDWKOGQ-MDMSPXHWSA-N |
| XLogP | 1.37 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|