C23H18FNO2 — CID 1049966
ethyl 2-[3-(4-fluorophenyl)benzo[f]quinolin-1-yl]acetate (PubChem CID 1049966) has the molecular formula C23H18FNO2 and a molecular weight of 359.40 g/mol. Its IUPAC name is ethyl 2-[3-(4-fluorophenyl)benzo[f]quinolin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(4-fluorophenyl)benzo[f]quinolin-1-yl]acetate |
|---|---|
| PubChem CID | 1049966 |
| Molecular Formula | C23H18FNO2 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | ethyl 2-[3-(4-fluorophenyl)benzo[f]quinolin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(-c2ccc(F)cc2)nc2ccc3ccccc3c12 |
| InChI | InChI=1S/C23H18FNO2/c1-2-27-22(26)14-17-13-21(16-7-10-18(24)11-8-16)25-20-12-9-15-5-3-4-6-19(15)23(17)20/h3-13H,2,14H2,1H3 |
| InChIKey | GYLMXEAZQPHGCX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|