C16H28BrN3O — CID 104998263
N-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-methyloxolan-3-yl)ethyl]propan-1-amine (PubChem CID 104998263) has the molecular formula C16H28BrN3O and a molecular weight of 358.32 g/mol. Its IUPAC name is N-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-methyloxolan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-methyloxolan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104998263 |
| Molecular Formula | C16H28BrN3O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-(2-methyloxolan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1c(Br)c(C)nn1CC)C1CCOC1C |
| InChI | InChI=1S/C16H28BrN3O/c1-5-8-18-14(13-7-9-21-12(13)4)10-15-16(17)11(3)19-20(15)6-2/h12-14,18H,5-10H2,1-4H3 |
| InChIKey | OBSVFRHFYJFQRX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |