C15H22ClN3OS — CID 104998879
2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(4-methoxythiophen-2-yl)ethanamine (PubChem CID 104998879) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(4-methoxythiophen-2-yl)ethanamine.
| Compound Name | 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(4-methoxythiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 104998879 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-N-ethyl-1-(4-methoxythiophen-2-yl)ethanamine |
| SMILES | CCNC(Cc1c(Cl)c(C)nn1CC)c1cc(OC)cs1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-5-17-12(14-7-11(20-4)9-21-14)8-13-15(16)10(3)18-19(13)6-2/h7,9,12,17H,5-6,8H2,1-4H3 |
| InChIKey | CINOTQGVPFIVJB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |